C20H20N5O6P — CID 118952572
[1-(6-aminopurin-9-yl)ethoxy-diphenoxymethyl]phosphonic acid (PubChem CID 118952572) has the molecular formula C20H20N5O6P and a molecular weight of 457.38 g/mol. Its IUPAC name is [1-(6-aminopurin-9-yl)ethoxy-diphenoxymethyl]phosphonic acid.
| Compound Name | [1-(6-aminopurin-9-yl)ethoxy-diphenoxymethyl]phosphonic acid |
|---|---|
| PubChem CID | 118952572 |
| Molecular Formula | C20H20N5O6P |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | [1-(6-aminopurin-9-yl)ethoxy-diphenoxymethyl]phosphonic acid |
| SMILES | CC(OC(Oc1ccccc1)(Oc1ccccc1)P(=O)(O)O)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C20H20N5O6P/c1-14(25-13-24-17-18(21)22-12-23-19(17)25)29-20(32(26,27)28,30-15-8-4-2-5-9-15)31-16-10-6-3-7-11-16/h2-14H,1H3,(H2,21,22,23)(H2,26,27,28) |
| InChIKey | VJRYTASXIXPXGG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 154.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|