C16H17N7O3 — CID 167947694
N-[3-(2-amino-2-oxoethoxy)phenyl]-2-(6-aminopurin-9-yl)propanamide (PubChem CID 167947694) has the molecular formula C16H17N7O3 and a molecular weight of 355.36 g/mol. Its IUPAC name is N-[3-(2-amino-2-oxoethoxy)phenyl]-2-(6-aminopurin-9-yl)propanamide.
| Compound Name | N-[3-(2-amino-2-oxoethoxy)phenyl]-2-(6-aminopurin-9-yl)propanamide |
|---|---|
| PubChem CID | 167947694 |
| Molecular Formula | C16H17N7O3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-[3-(2-amino-2-oxoethoxy)phenyl]-2-(6-aminopurin-9-yl)propanamide |
| SMILES | CC(C(=O)Nc1cccc(OCC(N)=O)c1)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C16H17N7O3/c1-9(23-8-21-13-14(18)19-7-20-15(13)23)16(25)22-10-3-2-4-11(5-10)26-6-12(17)24/h2-5,7-9H,6H2,1H3,(H2,17,24)(H,22,25)(H2,18,19,20) |
| InChIKey | IYOFSPMVVRFTRA-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 151.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |