C18H17N3O4 — CID 24649964
N-[3-(2-amino-2-oxoethoxy)phenyl]-2-(4-cyanophenoxy)propanamide (PubChem CID 24649964) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is N-[3-(2-amino-2-oxoethoxy)phenyl]-2-(4-cyanophenoxy)propanamide.
| Compound Name | N-[3-(2-amino-2-oxoethoxy)phenyl]-2-(4-cyanophenoxy)propanamide |
|---|---|
| PubChem CID | 24649964 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-[3-(2-amino-2-oxoethoxy)phenyl]-2-(4-cyanophenoxy)propanamide |
| SMILES | CC(Oc1ccc(C#N)cc1)C(=O)Nc1cccc(OCC(N)=O)c1 |
| InChI | InChI=1S/C18H17N3O4/c1-12(25-15-7-5-13(10-19)6-8-15)18(23)21-14-3-2-4-16(9-14)24-11-17(20)22/h2-9,12H,11H2,1H3,(H2,20,22)(H,21,23) |
| InChIKey | AYDZEVLZOXLJMW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |