C9H14N5O6P — CID 175123312
[1-(6-aminopurin-9-yl)-2-hydroxypropoxy]methyl dihydrogen phosphate (PubChem CID 175123312) has the molecular formula C9H14N5O6P and a molecular weight of 319.21 g/mol. Its IUPAC name is [1-(6-aminopurin-9-yl)-2-hydroxypropoxy]methyl dihydrogen phosphate.
| Compound Name | [1-(6-aminopurin-9-yl)-2-hydroxypropoxy]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 175123312 |
| Molecular Formula | C9H14N5O6P |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | [1-(6-aminopurin-9-yl)-2-hydroxypropoxy]methyl dihydrogen phosphate |
| SMILES | CC(O)C(OCOP(=O)(O)O)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C9H14N5O6P/c1-5(15)9(19-4-20-21(16,17)18)14-3-13-6-7(10)11-2-12-8(6)14/h2-3,5,9,15H,4H2,1H3,(H2,10,11,12)(H2,16,17,18) |
| InChIKey | SWIFXLGBYYZHLE-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 165.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|