C14H17N10O4P — CID 69163961
9-[(6-aminopurin-9-yl)oxy-(propan-2-yloxymethyl)phosphoryl]oxypurin-6-amine (PubChem CID 69163961) has the molecular formula C14H17N10O4P and a molecular weight of 420.33 g/mol. Its IUPAC name is 9-[(6-aminopurin-9-yl)oxy-(propan-2-yloxymethyl)phosphoryl]oxypurin-6-amine.
| Compound Name | 9-[(6-aminopurin-9-yl)oxy-(propan-2-yloxymethyl)phosphoryl]oxypurin-6-amine |
|---|---|
| PubChem CID | 69163961 |
| Molecular Formula | C14H17N10O4P |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 9-[(6-aminopurin-9-yl)oxy-(propan-2-yloxymethyl)phosphoryl]oxypurin-6-amine |
| SMILES | CC(C)OCP(=O)(On1cnc2c(N)ncnc21)On1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C14H17N10O4P/c1-8(2)26-7-29(25,27-23-5-21-9-11(15)17-3-19-13(9)23)28-24-6-22-10-12(16)18-4-20-14(10)24/h3-6,8H,7H2,1-2H3,(H2,15,17,19)(H2,16,18,20) |
| InChIKey | SYVHKTVWEAIGEX-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 184.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|