C18H34N6O4P+ — CID 11798370
[3-(6-aminopurin-9-yl)-2-[di(propan-2-yloxy)phosphorylmethoxy]propyl]-trimethylazanium (PubChem CID 11798370) has the molecular formula C18H34N6O4P+ and a molecular weight of 429.48 g/mol. Its IUPAC name is [3-(6-aminopurin-9-yl)-2-[di(propan-2-yloxy)phosphorylmethoxy]propyl]-trimethylazanium.
| Compound Name | [3-(6-aminopurin-9-yl)-2-[di(propan-2-yloxy)phosphorylmethoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 11798370 |
| Molecular Formula | C18H34N6O4P+ |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | [3-(6-aminopurin-9-yl)-2-[di(propan-2-yloxy)phosphorylmethoxy]propyl]-trimethylazanium |
| SMILES | CC(C)OP(=O)(COC(Cn1cnc2c(N)ncnc21)C[N+](C)(C)C)OC(C)C |
| InChI | InChI=1S/C18H34N6O4P/c1-13(2)27-29(25,28-14(3)4)12-26-15(9-24(5,6)7)8-23-11-22-16-17(19)20-10-21-18(16)23/h10-11,13-15H,8-9,12H2,1-7H3,(H2,19,20,21)/q+1 |
| InChIKey | VLOYCXBZINBVCH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|