C17H28N5O4P — CID 90874712
9-[[(1R,2S)-1-[di(propan-2-yloxy)phosphorylmethoxy]-2-methylcyclopropyl]methyl]purin-6-amine (PubChem CID 90874712) has the molecular formula C17H28N5O4P and a molecular weight of 397.42 g/mol. Its IUPAC name is 9-[[(1R,2S)-1-[di(propan-2-yloxy)phosphorylmethoxy]-2-methylcyclopropyl]methyl]purin-6-amine.
| Compound Name | 9-[[(1R,2S)-1-[di(propan-2-yloxy)phosphorylmethoxy]-2-methylcyclopropyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 90874712 |
| Molecular Formula | C17H28N5O4P |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 9-[[(1R,2S)-1-[di(propan-2-yloxy)phosphorylmethoxy]-2-methylcyclopropyl]methyl]purin-6-amine |
| SMILES | CC(C)OP(=O)(CO[C@]1(Cn2cnc3c(N)ncnc32)C[C@@H]1C)OC(C)C |
| InChI | InChI=1S/C17H28N5O4P/c1-11(2)25-27(23,26-12(3)4)10-24-17(6-13(17)5)7-22-9-21-14-15(18)19-8-20-16(14)22/h8-9,11-13H,6-7,10H2,1-5H3,(H2,18,19,20)/t13-,17-/m0/s1 |
| InChIKey | QJJSGDOIDONISO-GUYCJALGSA-N |
| XLogP | 3.20 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|