C18H30N5O3P — CID 10475784
9-[(1S,3R)-3-[2-di(propan-2-yloxy)phosphorylethyl]cyclopentyl]purin-6-amine (PubChem CID 10475784) has the molecular formula C18H30N5O3P and a molecular weight of 395.44 g/mol. Its IUPAC name is 9-[(1S,3R)-3-[2-di(propan-2-yloxy)phosphorylethyl]cyclopentyl]purin-6-amine.
| Compound Name | 9-[(1S,3R)-3-[2-di(propan-2-yloxy)phosphorylethyl]cyclopentyl]purin-6-amine |
|---|---|
| PubChem CID | 10475784 |
| Molecular Formula | C18H30N5O3P |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 9-[(1S,3R)-3-[2-di(propan-2-yloxy)phosphorylethyl]cyclopentyl]purin-6-amine |
| SMILES | CC(C)OP(=O)(CC[C@@H]1CC[C@H](n2cnc3c(N)ncnc32)C1)OC(C)C |
| InChI | InChI=1S/C18H30N5O3P/c1-12(2)25-27(24,26-13(3)4)8-7-14-5-6-15(9-14)23-11-22-16-17(19)20-10-21-18(16)23/h10-15H,5-9H2,1-4H3,(H2,19,20,21)/t14-,15-/m0/s1 |
| InChIKey | JIIXESLUAUXBII-GJZGRUSLSA-N |
| XLogP | 4.18 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|