C13H17N5O2 — CID 15659288
methyl 2-[(1R,3R)-3-(6-aminopurin-9-yl)cyclopentyl]acetate (PubChem CID 15659288) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is methyl 2-[(1R,3R)-3-(6-aminopurin-9-yl)cyclopentyl]acetate.
| Compound Name | methyl 2-[(1R,3R)-3-(6-aminopurin-9-yl)cyclopentyl]acetate |
|---|---|
| PubChem CID | 15659288 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | methyl 2-[(1R,3R)-3-(6-aminopurin-9-yl)cyclopentyl]acetate |
| SMILES | COC(=O)C[C@@H]1CC[C@@H](n2cnc3c(N)ncnc32)C1 |
| InChI | InChI=1S/C13H17N5O2/c1-20-10(19)5-8-2-3-9(4-8)18-7-17-11-12(14)15-6-16-13(11)18/h6-9H,2-5H2,1H3,(H2,14,15,16)/t8-,9-/m1/s1 |
| InChIKey | YBLVFYHCDLXAIF-RKDXNWHRSA-N |
| XLogP | 1.31 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |