C15H19N5O2 — CID 102068004
methyl (1R,3aS,6S,6aR)-6-(6-aminopurin-9-yl)-1,2,3,3a,4,5,6,6a-octahydropentalene-1-carboxylate (PubChem CID 102068004) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is methyl (1R,3aS,6S,6aR)-6-(6-aminopurin-9-yl)-1,2,3,3a,4,5,6,6a-octahydropentalene-1-carboxylate.
| Compound Name | methyl (1R,3aS,6S,6aR)-6-(6-aminopurin-9-yl)-1,2,3,3a,4,5,6,6a-octahydropentalene-1-carboxylate |
|---|---|
| PubChem CID | 102068004 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | methyl (1R,3aS,6S,6aR)-6-(6-aminopurin-9-yl)-1,2,3,3a,4,5,6,6a-octahydropentalene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@H]2CC[C@H](n3cnc4c(N)ncnc43)[C@H]21 |
| InChI | InChI=1S/C15H19N5O2/c1-22-15(21)9-4-2-8-3-5-10(11(8)9)20-7-19-12-13(16)17-6-18-14(12)20/h6-11H,2-5H2,1H3,(H2,16,17,18)/t8-,9+,10-,11+/m0/s1 |
| InChIKey | KATZCIZYUHUNMT-ZRUFSTJUSA-N |
| XLogP | 1.56 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |