C14H17N5O3 — CID 102078558
[(1S,2R,4R,5R)-4-(6-aminopurin-9-yl)-1-methyl-6-oxabicyclo[3.1.0]hexan-2-yl]methyl acetate (PubChem CID 102078558) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is [(1S,2R,4R,5R)-4-(6-aminopurin-9-yl)-1-methyl-6-oxabicyclo[3.1.0]hexan-2-yl]methyl acetate.
| Compound Name | [(1S,2R,4R,5R)-4-(6-aminopurin-9-yl)-1-methyl-6-oxabicyclo[3.1.0]hexan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102078558 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | [(1S,2R,4R,5R)-4-(6-aminopurin-9-yl)-1-methyl-6-oxabicyclo[3.1.0]hexan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C[C@@H](n2cnc3c(N)ncnc32)[C@H]2O[C@@]12C |
| InChI | InChI=1S/C14H17N5O3/c1-7(20)21-4-8-3-9(11-14(8,2)22-11)19-6-18-10-12(15)16-5-17-13(10)19/h5-6,8-9,11H,3-4H2,1-2H3,(H2,15,16,17)/t8-,9-,11-,14+/m1/s1 |
| InChIKey | DKUMSCWICIMKIN-FTBFGRRBSA-N |
| XLogP | 0.69 |
| TPSA | 108.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|