C12H13BrFN5O3 — CID 11610450
[(2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-3-bromo-4-fluorooxolan-2-yl]methyl acetate (PubChem CID 11610450) has the molecular formula C12H13BrFN5O3 and a molecular weight of 374.17 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-3-bromo-4-fluorooxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-3-bromo-4-fluorooxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11610450 |
| Molecular Formula | C12H13BrFN5O3 |
| Molecular Weight | 374.17 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | [(2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-3-bromo-4-fluorooxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](F)[C@H]1Br |
| InChI | InChI=1S/C12H13BrFN5O3/c1-5(20)21-2-6-7(13)8(14)12(22-6)19-4-18-9-10(15)16-3-17-11(9)19/h3-4,6-8,12H,2H2,1H3,(H2,15,16,17)/t6-,7+,8-,12-/m1/s1 |
| InChIKey | JIUPCWUUZAFPGE-BSFVXNEUSA-N |
| XLogP | 0.97 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.17 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|