C15H21N5O4 — CID 19996044
butyl 4-(6-aminopurin-9-yl)-2,3-dihydroxycyclopentane-1-carboxylate (PubChem CID 19996044) has the molecular formula C15H21N5O4 and a molecular weight of 335.36 g/mol. Its IUPAC name is butyl 4-(6-aminopurin-9-yl)-2,3-dihydroxycyclopentane-1-carboxylate.
| Compound Name | butyl 4-(6-aminopurin-9-yl)-2,3-dihydroxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 19996044 |
| Molecular Formula | C15H21N5O4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | butyl 4-(6-aminopurin-9-yl)-2,3-dihydroxycyclopentane-1-carboxylate |
| SMILES | CCCCOC(=O)C1CC(n2cnc3c(N)ncnc32)C(O)C1O |
| InChI | InChI=1S/C15H21N5O4/c1-2-3-4-24-15(23)8-5-9(12(22)11(8)21)20-7-19-10-13(16)17-6-18-14(10)20/h6-9,11-12,21-22H,2-5H2,1H3,(H2,16,17,18) |
| InChIKey | NMIRORLHEYHGPW-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|