C11H16N5O6P — CID 15954478
[(2R,3S)-4-(6-aminopurin-9-yl)-2,3-dihydroxycyclopentyl]methyl dihydrogen phosphate (PubChem CID 15954478) has the molecular formula C11H16N5O6P and a molecular weight of 345.25 g/mol. Its IUPAC name is [(2R,3S)-4-(6-aminopurin-9-yl)-2,3-dihydroxycyclopentyl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S)-4-(6-aminopurin-9-yl)-2,3-dihydroxycyclopentyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 15954478 |
| Molecular Formula | C11H16N5O6P |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | [(2R,3S)-4-(6-aminopurin-9-yl)-2,3-dihydroxycyclopentyl]methyl dihydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2C1CC(COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H16N5O6P/c12-10-7-11(14-3-13-10)16(4-15-7)6-1-5(8(17)9(6)18)2-22-23(19,20)21/h3-6,8-9,17-18H,1-2H2,(H2,12,13,14)(H2,19,20,21)/t5?,6?,8-,9+/m1/s1 |
| InChIKey | ZLHJFTIXCUYZSQ-MOJGERESSA-N |
| XLogP | -1.20 |
| TPSA | 176.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|