C21H29N8O9P — CID 145459094
[(1R,2S,3R,5R)-3-(4-amino-2-oxopyrimidin-1-yl)-2-hydroxy-5-(hydroxymethyl)cyclopentyl] [(1R,2R,3S,4R)-4-(6-aminopurin-9-yl)-2,3-dihydroxycyclopentyl]methyl hydrogen phosphate (PubChem CID 145459094) has the molecular formula C21H29N8O9P and a molecular weight of 568.48 g/mol. Its IUPAC name is [(1R,2S,3R,5R)-3-(4-amino-2-oxopyrimidin-1-yl)-2-hydroxy-5-(hydroxymethyl)cyclopentyl] [(1R,2R,3S,4R)-4-(6-aminopurin-9-yl)-2,3-dihydroxycyclopentyl]methyl hydrogen phosphate.
| Compound Name | [(1R,2S,3R,5R)-3-(4-amino-2-oxopyrimidin-1-yl)-2-hydroxy-5-(hydroxymethyl)cyclopentyl] [(1R,2R,3S,4R)-4-(6-aminopurin-9-yl)-2,3-dihydroxycyclopentyl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 145459094 |
| Molecular Formula | C21H29N8O9P |
| Molecular Weight | 568.48 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | [(1R,2S,3R,5R)-3-(4-amino-2-oxopyrimidin-1-yl)-2-hydroxy-5-(hydroxymethyl)cyclopentyl] [(1R,2R,3S,4R)-4-(6-aminopurin-9-yl)-2,3-dihydroxycyclopentyl]methyl hydrogen phosphate |
| SMILES | Nc1ccn([C@@H]2C[C@H](CO)[C@@H](OP(=O)(O)OC[C@H]3C[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C21H29N8O9P/c22-13-1-2-28(21(34)27-13)12-3-9(5-30)18(17(12)33)38-39(35,36)37-6-10-4-11(16(32)15(10)31)29-8-26-14-19(23)24-7-25-20(14)29/h1-2,7-12,15-18,30-33H,3-6H2,(H,35,36)(H2,22,27,34)(H2,23,24,25)/t9-,10-,11-,12-,15-,16+,17+,18-/m1/s1 |
| InChIKey | XBNMUUWVWXAQRS-JXICNGGMSA-N |
| XLogP | -2.05 |
| TPSA | 267.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.48 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|