C13H22N5O12P3 — CID 154589599
[[(1R,3R,4R)-4-(6-aminopurin-9-yl)-2,3-dimethoxycyclopentyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 154589599) has the molecular formula C13H22N5O12P3 and a molecular weight of 533.26 g/mol. Its IUPAC name is [[(1R,3R,4R)-4-(6-aminopurin-9-yl)-2,3-dimethoxycyclopentyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1R,3R,4R)-4-(6-aminopurin-9-yl)-2,3-dimethoxycyclopentyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 154589599 |
| Molecular Formula | C13H22N5O12P3 |
| Molecular Weight | 533.26 g/mol |
| Exact Mass | 533.05 |
| IUPAC Name | [[(1R,3R,4R)-4-(6-aminopurin-9-yl)-2,3-dimethoxycyclopentyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | COC1[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C[C@@H](n2cnc3c(N)ncnc32)[C@H]1OC |
| InChI | InChI=1S/C13H22N5O12P3/c1-26-10-7(4-28-32(22,23)30-33(24,25)29-31(19,20)21)3-8(11(10)27-2)18-6-17-9-12(14)15-5-16-13(9)18/h5-8,10-11H,3-4H2,1-2H3,(H,22,23)(H,24,25)(H2,14,15,16)(H2,19,20,21)/t7-,8-,10?,11-/m1/s1 |
| InChIKey | KFEJTROVGHLIEO-ZUCSDGAKSA-N |
| XLogP | 0.34 |
| TPSA | 247.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|