C13H22N5O10P3 — CID 166711791
[[(1R,4R)-4-(6-aminopurin-9-yl)-3,3-dimethylcyclopentyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 166711791) has the molecular formula C13H22N5O10P3 and a molecular weight of 501.27 g/mol. Its IUPAC name is [[(1R,4R)-4-(6-aminopurin-9-yl)-3,3-dimethylcyclopentyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1R,4R)-4-(6-aminopurin-9-yl)-3,3-dimethylcyclopentyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 166711791 |
| Molecular Formula | C13H22N5O10P3 |
| Molecular Weight | 501.27 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | [[(1R,4R)-4-(6-aminopurin-9-yl)-3,3-dimethylcyclopentyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC1(C)C[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C13H22N5O10P3/c1-13(2)4-8(5-26-30(22,23)28-31(24,25)27-29(19,20)21)3-9(13)18-7-17-10-11(14)15-6-16-12(10)18/h6-9H,3-5H2,1-2H3,(H,22,23)(H,24,25)(H2,14,15,16)(H2,19,20,21)/t8-,9+/m0/s1 |
| InChIKey | OMNCNVIHWFISPF-DTWKUNHWSA-N |
| XLogP | 1.73 |
| TPSA | 229.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|