C11H16N5O10P3 — CID 21059656
[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 21059656) has the molecular formula C11H16N5O10P3 and a molecular weight of 471.20 g/mol. Its IUPAC name is [[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 21059656 |
| Molecular Formula | C11H16N5O10P3 |
| Molecular Weight | 471.20 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | [[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1C=C[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C1 |
| InChI | InChI=1S/C11H16N5O10P3/c12-10-9-11(14-5-13-10)16(6-15-9)8-2-1-7(3-8)4-24-28(20,21)26-29(22,23)25-27(17,18)19/h1-2,5-8H,3-4H2,(H,20,21)(H,22,23)(H2,12,13,14)(H2,17,18,19)/t7-,8+/m0/s1 |
| InChIKey | MXZMZWAHVFRGLZ-JGVFFNPUSA-N |
| XLogP | 0.87 |
| TPSA | 229.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|