C14H21N5O2S — CID 167435817
(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-pentyl-4-sulfanyloxolan-3-ol (PubChem CID 167435817) has the molecular formula C14H21N5O2S and a molecular weight of 323.42 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-pentyl-4-sulfanyloxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-pentyl-4-sulfanyloxolan-3-ol |
|---|---|
| PubChem CID | 167435817 |
| Molecular Formula | C14H21N5O2S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-pentyl-4-sulfanyloxolan-3-ol |
| SMILES | CCCCC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](S)[C@@H]1O |
| InChI | InChI=1S/C14H21N5O2S/c1-2-3-4-5-8-10(20)11(22)14(21-8)19-7-18-9-12(15)16-6-17-13(9)19/h6-8,10-11,14,20,22H,2-5H2,1H3,(H2,15,16,17)/t8-,10-,11-,14-/m1/s1 |
| InChIKey | NPSAYWFNGJSCPV-IDTAVKCVSA-N |
| XLogP | 1.55 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|