C13H17N5O2S — CID 87441289
(2R,3S,4S,5R)-2-(6-aminopurin-9-yl)-5-but-3-enyl-4-sulfanyloxolan-3-ol (PubChem CID 87441289) has the molecular formula C13H17N5O2S and a molecular weight of 307.38 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(6-aminopurin-9-yl)-5-but-3-enyl-4-sulfanyloxolan-3-ol.
| Compound Name | (2R,3S,4S,5R)-2-(6-aminopurin-9-yl)-5-but-3-enyl-4-sulfanyloxolan-3-ol |
|---|---|
| PubChem CID | 87441289 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | (2R,3S,4S,5R)-2-(6-aminopurin-9-yl)-5-but-3-enyl-4-sulfanyloxolan-3-ol |
| SMILES | C=CCC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1S |
| InChI | InChI=1S/C13H17N5O2S/c1-2-3-4-7-10(21)9(19)13(20-7)18-6-17-8-11(14)15-5-16-12(8)18/h2,5-7,9-10,13,19,21H,1,3-4H2,(H2,14,15,16)/t7-,9-,10-,13-/m1/s1 |
| InChIKey | SQGBGLZLIXDBPX-QYVSTXNMSA-N |
| XLogP | 0.93 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|