C15H24N8O2 — CID 133065213
(2R)-2,6-diamino-1-[(3S,4S)-3-(6-aminopurin-9-yl)-4-hydroxypyrrolidin-1-yl]hexan-1-one (PubChem CID 133065213) has the molecular formula C15H24N8O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is (2R)-2,6-diamino-1-[(3S,4S)-3-(6-aminopurin-9-yl)-4-hydroxypyrrolidin-1-yl]hexan-1-one.
| Compound Name | (2R)-2,6-diamino-1-[(3S,4S)-3-(6-aminopurin-9-yl)-4-hydroxypyrrolidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 133065213 |
| Molecular Formula | C15H24N8O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (2R)-2,6-diamino-1-[(3S,4S)-3-(6-aminopurin-9-yl)-4-hydroxypyrrolidin-1-yl]hexan-1-one |
| SMILES | NCCCC[C@@H](N)C(=O)N1C[C@H](O)[C@@H](n2cnc3c(N)ncnc32)C1 |
| InChI | InChI=1S/C15H24N8O2/c16-4-2-1-3-9(17)15(25)22-5-10(11(24)6-22)23-8-21-12-13(18)19-7-20-14(12)23/h7-11,24H,1-6,16-17H2,(H2,18,19,20)/t9-,10+,11+/m1/s1 |
| InChIKey | BJLAIFFBSKYYCL-VWYCJHECSA-N |
| XLogP | -1.39 |
| TPSA | 162.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|