C11H17N6O4P — CID 102480260
2-[(3R,4R)-3-(6-aminopurin-9-yl)-4-hydroxypyrrolidin-1-yl]ethylphosphonic acid (PubChem CID 102480260) has the molecular formula C11H17N6O4P and a molecular weight of 328.27 g/mol. Its IUPAC name is 2-[(3R,4R)-3-(6-aminopurin-9-yl)-4-hydroxypyrrolidin-1-yl]ethylphosphonic acid.
| Compound Name | 2-[(3R,4R)-3-(6-aminopurin-9-yl)-4-hydroxypyrrolidin-1-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 102480260 |
| Molecular Formula | C11H17N6O4P |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 2-[(3R,4R)-3-(6-aminopurin-9-yl)-4-hydroxypyrrolidin-1-yl]ethylphosphonic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1CN(CCP(=O)(O)O)C[C@H]1O |
| InChI | InChI=1S/C11H17N6O4P/c12-10-9-11(14-5-13-10)17(6-15-9)7-3-16(4-8(7)18)1-2-22(19,20)21/h5-8,18H,1-4H2,(H2,12,13,14)(H2,19,20,21)/t7-,8-/m1/s1 |
| InChIKey | HEFYJKFPHJGTNH-HTQZYQBOSA-N |
| XLogP | -1.20 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|