C11H16N5O8P2+ — CID 57356996
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(2-phosphonoethyl)oxolan-3-yl]oxy-hydroxy-oxophosphanium (PubChem CID 57356996) has the molecular formula C11H16N5O8P2+ and a molecular weight of 408.22 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(2-phosphonoethyl)oxolan-3-yl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(2-phosphonoethyl)oxolan-3-yl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 57356996 |
| Molecular Formula | C11H16N5O8P2+ |
| Molecular Weight | 408.22 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(2-phosphonoethyl)oxolan-3-yl]oxy-hydroxy-oxophosphanium |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CCP(=O)(O)O)[C@@H](O[P+](=O)O)[C@H]1O |
| InChI | InChI=1S/C11H15N5O8P2/c12-9-6-10(14-3-13-9)16(4-15-6)11-7(17)8(24-25(18)19)5(23-11)1-2-26(20,21)22/h3-5,7-8,11,17H,1-2H2,(H4-,12,13,14,18,19,20,21,22)/p+1/t5-,7-,8-,11-/m1/s1 |
| InChIKey | LSMRVAVBRAZBPC-IOSLPCCCSA-O |
| XLogP | -0.73 |
| TPSA | 203.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.22 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|