C13H19N5O6P+ — CID 166590642
[(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-propoxyoxolan-3-yl]oxy-hydroxy-oxophosphanium (PubChem CID 166590642) has the molecular formula C13H19N5O6P+ and a molecular weight of 372.30 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-propoxyoxolan-3-yl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-propoxyoxolan-3-yl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 166590642 |
| Molecular Formula | C13H19N5O6P+ |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-propoxyoxolan-3-yl]oxy-hydroxy-oxophosphanium |
| SMILES | CCCOC1[C@@H](O[P+](=O)O)[C@@H](CO)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C13H18N5O6P/c1-2-3-22-10-9(24-25(20)21)7(4-19)23-13(10)18-6-17-8-11(14)15-5-16-12(8)18/h5-7,9-10,13,19H,2-4H2,1H3,(H2-,14,15,16,20,21)/p+1/t7-,9+,10?,13-/m1/s1 |
| InChIKey | FLZJMQKNLLARHY-ZIUXOXTBSA-O |
| XLogP | 0.13 |
| TPSA | 154.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|