C15H20N5O5P — CID 174069359
[(2R,5R)-5-(6-aminopurin-9-yl)-4-[(E)-2-methylbut-2-enoxy]-3-phosphorosooxyoxolan-2-yl]methanol (PubChem CID 174069359) has the molecular formula C15H20N5O5P and a molecular weight of 381.33 g/mol. Its IUPAC name is [(2R,5R)-5-(6-aminopurin-9-yl)-4-[(E)-2-methylbut-2-enoxy]-3-phosphorosooxyoxolan-2-yl]methanol.
| Compound Name | [(2R,5R)-5-(6-aminopurin-9-yl)-4-[(E)-2-methylbut-2-enoxy]-3-phosphorosooxyoxolan-2-yl]methanol |
|---|---|
| PubChem CID | 174069359 |
| Molecular Formula | C15H20N5O5P |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | [(2R,5R)-5-(6-aminopurin-9-yl)-4-[(E)-2-methylbut-2-enoxy]-3-phosphorosooxyoxolan-2-yl]methanol |
| SMILES | C/C=C(\C)COC1C(OP=O)[C@@H](CO)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C15H20N5O5P/c1-3-8(2)5-23-12-11(25-26-22)9(4-21)24-15(12)20-7-19-10-13(16)17-6-18-14(10)20/h3,6-7,9,11-12,15,21H,4-5H2,1-2H3,(H2,16,17,18)/b8-3+/t9-,11?,12?,15-/m1/s1 |
| InChIKey | IVKCAIFXCXXRIO-XNHFUEDTSA-N |
| XLogP | 1.24 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|