C11H15N5O5PS+ — CID 135178523
[5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl]oxy-oxo-sulfanylphosphanium (PubChem CID 135178523) has the molecular formula C11H15N5O5PS+ and a molecular weight of 360.31 g/mol. Its IUPAC name is [5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl]oxy-oxo-sulfanylphosphanium.
| Compound Name | [5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl]oxy-oxo-sulfanylphosphanium |
|---|---|
| PubChem CID | 135178523 |
| Molecular Formula | C11H15N5O5PS+ |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | [5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl]oxy-oxo-sulfanylphosphanium |
| SMILES | COC1C(O[P+](=O)S)C(CO)OC1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C11H14N5O5PS/c1-19-8-7(21-22(18)23)5(2-17)20-11(8)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17H,2H2,1H3,(H2-,12,13,14,18,23)/p+1 |
| InChIKey | ADLMGUVOPWDOIU-UHFFFAOYSA-O |
| XLogP | 0.29 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|