C11H15N5O6PS+ — CID 137293470
[5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl]oxy-oxo-sulfanylphosphanium (PubChem CID 137293470) has the molecular formula C11H15N5O6PS+ and a molecular weight of 376.31 g/mol. Its IUPAC name is [5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl]oxy-oxo-sulfanylphosphanium.
| Compound Name | [5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl]oxy-oxo-sulfanylphosphanium |
|---|---|
| PubChem CID | 137293470 |
| Molecular Formula | C11H15N5O6PS+ |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | [5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl]oxy-oxo-sulfanylphosphanium |
| SMILES | COC1C(O[P+](=O)S)C(CO)OC1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C11H14N5O6PS/c1-20-7-6(22-23(19)24)4(2-17)21-10(7)16-3-13-5-8(16)14-11(12)15-9(5)18/h3-4,6-7,10,17H,2H2,1H3,(H3-,12,14,15,18,19,24)/p+1 |
| InChIKey | GWOPYRGTAJLVHB-UHFFFAOYSA-O |
| XLogP | -0.42 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|