C10H12N5O4Se — CID 137242518
selenoguanosine (PubChem CID 137242518) has the molecular formula C10H12N5O4Se and a molecular weight of 345.20 g/mol.
| Compound Name | selenoguanosine |
|---|---|
| PubChem CID | 137242518 |
| Molecular Formula | C10H12N5O4Se |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | — |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2[Se])c(=O)[nH]1 |
| InChI | InChI=1S/C10H12N5O4Se/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(20)5(17)3(1-16)19-9/h2-3,5-6,9,16-17H,1H2,(H3,11,13,14,18)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | FWWROTZKJVCOGD-UUOKFMHZSA-N |
| XLogP | -2.09 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|