C11H16FN5O4 — CID 158119606
2-amino-9-[3-(18F)fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;methane (PubChem CID 158119606) has the molecular formula C11H16FN5O4 and a molecular weight of 300.28 g/mol. Its IUPAC name is 2-amino-9-[3-(18F)fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;methane.
| Compound Name | 2-amino-9-[3-(18F)fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;methane |
|---|---|
| PubChem CID | 158119606 |
| Molecular Formula | C11H16FN5O4 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 2-amino-9-[3-(18F)fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;methane |
| SMILES | C.Nc1nc2c(ncn2C2OC(CO)C(O)C2[18F])c(=O)[nH]1 |
| InChI | InChI=1S/C10H12FN5O4.CH4/c11-4-6(18)3(1-17)20-9(4)16-2-13-5-7(16)14-10(12)15-8(5)19;/h2-4,6,9,17-18H,1H2,(H3,12,14,15,19);1H4/i11-1; |
| InChIKey | FRLDVJXBPAVRRM-ICTZXKMBSA-N |
| XLogP | -1.07 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |