C11H13N5O5 — CID 137148772
(2R,3S,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolane-3-carbaldehyde (PubChem CID 137148772) has the molecular formula C11H13N5O5 and a molecular weight of 295.26 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolane-3-carbaldehyde.
| Compound Name | (2R,3S,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolane-3-carbaldehyde |
|---|---|
| PubChem CID | 137148772 |
| Molecular Formula | C11H13N5O5 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | (2R,3S,4R,5R)-2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolane-3-carbaldehyde |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](CO)[C@H](O)[C@@H]2C=O)c(=O)[nH]1 |
| InChI | InChI=1S/C11H13N5O5/c12-11-14-8-6(9(20)15-11)13-3-16(8)10-4(1-17)7(19)5(2-18)21-10/h1,3-5,7,10,18-19H,2H2,(H3,12,14,15,20)/t4-,5+,7+,10+/m0/s1 |
| InChIKey | ABOTWQZADLQNMP-ZODYKUIJSA-N |
| XLogP | -2.23 |
| TPSA | 156.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|