C13H15N5O6P+ — CID 169023865
[(2R,4S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-prop-2-ynoxyoxolan-3-yl]oxy-hydroxy-oxophosphanium (PubChem CID 169023865) has the molecular formula C13H15N5O6P+ and a molecular weight of 368.27 g/mol. Its IUPAC name is [(2R,4S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-prop-2-ynoxyoxolan-3-yl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,4S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-prop-2-ynoxyoxolan-3-yl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 169023865 |
| Molecular Formula | C13H15N5O6P+ |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | [(2R,4S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-prop-2-ynoxyoxolan-3-yl]oxy-hydroxy-oxophosphanium |
| SMILES | C#CCO[C@H]1C(O[P+](=O)O)[C@@H](CO)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C13H14N5O6P/c1-2-3-22-10-9(24-25(20)21)7(4-19)23-13(10)18-6-17-8-11(14)15-5-16-12(8)18/h1,5-7,9-10,13,19H,3-4H2,(H2-,14,15,16,20,21)/p+1/t7-,9?,10+,13-/m1/s1 |
| InChIKey | ZJWVCBDZPCFBML-CXOKJZQJSA-O |
| XLogP | -0.65 |
| TPSA | 154.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|