C18H25N7O5 — CID 123566889
2,5-diamino-6-[5-(6-aminopurin-9-yl)-3-hydroxy-4-prop-2-ynoxyoxolan-2-yl]hexanoic acid (PubChem CID 123566889) has the molecular formula C18H25N7O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is 2,5-diamino-6-[5-(6-aminopurin-9-yl)-3-hydroxy-4-prop-2-ynoxyoxolan-2-yl]hexanoic acid.
| Compound Name | 2,5-diamino-6-[5-(6-aminopurin-9-yl)-3-hydroxy-4-prop-2-ynoxyoxolan-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 123566889 |
| Molecular Formula | C18H25N7O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 2,5-diamino-6-[5-(6-aminopurin-9-yl)-3-hydroxy-4-prop-2-ynoxyoxolan-2-yl]hexanoic acid |
| SMILES | C#CCOC1C(O)C(CC(N)CCC(N)C(=O)O)OC1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C18H25N7O5/c1-2-5-29-14-13(26)11(6-9(19)3-4-10(20)18(27)28)30-17(14)25-8-24-12-15(21)22-7-23-16(12)25/h1,7-11,13-14,17,26H,3-6,19-20H2,(H,27,28)(H2,21,22,23) |
| InChIKey | UKLLOMDQDKCMMH-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 197.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|