C14H15N5O6 — CID 57041525
prop-2-ynyl 2-[(2S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetate (PubChem CID 57041525) has the molecular formula C14H15N5O6 and a molecular weight of 349.30 g/mol. Its IUPAC name is prop-2-ynyl 2-[(2S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetate.
| Compound Name | prop-2-ynyl 2-[(2S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 57041525 |
| Molecular Formula | C14H15N5O6 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | prop-2-ynyl 2-[(2S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyacetate |
| SMILES | C#CCOC(=O)C(O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)C(O)C1O |
| InChI | InChI=1S/C14H15N5O6/c1-2-3-24-14(23)9(22)10-7(20)8(21)13(25-10)19-5-18-6-11(15)16-4-17-12(6)19/h1,4-5,7-10,13,20-22H,3H2,(H2,15,16,17)/t7?,8?,9?,10-,13+/m0/s1 |
| InChIKey | KCYSYYAEKGNBNA-YHAGKIETSA-N |
| XLogP | -2.43 |
| TPSA | 165.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|