C18H18BrN5O5 — CID 21120663
2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-1-[4-(bromomethyl)phenyl]-2-hydroxyethanone (PubChem CID 21120663) has the molecular formula C18H18BrN5O5 and a molecular weight of 464.28 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-1-[4-(bromomethyl)phenyl]-2-hydroxyethanone.
| Compound Name | 2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-1-[4-(bromomethyl)phenyl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 21120663 |
| Molecular Formula | C18H18BrN5O5 |
| Molecular Weight | 464.28 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-1-[4-(bromomethyl)phenyl]-2-hydroxyethanone |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](C(O)C(=O)c2ccc(CBr)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H18BrN5O5/c19-5-8-1-3-9(4-2-8)11(25)12(26)15-13(27)14(28)18(29-15)24-7-23-10-16(20)21-6-22-17(10)24/h1-4,6-7,12-15,18,26-28H,5H2,(H2,20,21,22)/t12?,13-,14+,15+,18+/m0/s1 |
| InChIKey | IYXQQOMXWUAAOK-JJSXZHHUSA-N |
| XLogP | 0.17 |
| TPSA | 156.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|