C14H16N6O5 — CID 88820554
2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxy-N-prop-2-ynylacetamide (PubChem CID 88820554) has the molecular formula C14H16N6O5 and a molecular weight of 348.32 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxy-N-prop-2-ynylacetamide.
| Compound Name | 2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxy-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 88820554 |
| Molecular Formula | C14H16N6O5 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxy-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)C(O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H16N6O5/c1-2-3-16-13(24)9(23)10-7(21)8(22)14(25-10)20-5-19-6-11(15)17-4-18-12(6)20/h1,4-5,7-10,14,21-23H,3H2,(H,16,24)(H2,15,17,18)/t7-,8+,9?,10-,14+/m0/s1 |
| InChIKey | GQYSAWBQQITTKM-PFNGQIKESA-N |
| XLogP | -2.86 |
| TPSA | 168.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|