C11H15N5O4Se — CID 90424594
(2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[hydroxy(methylselanyl)methyl]oxolane-3,4-diol (PubChem CID 90424594) has the molecular formula C11H15N5O4Se and a molecular weight of 360.23 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[hydroxy(methylselanyl)methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[hydroxy(methylselanyl)methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 90424594 |
| Molecular Formula | C11H15N5O4Se |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-[hydroxy(methylselanyl)methyl]oxolane-3,4-diol |
| SMILES | C[Se]C(O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H15N5O4Se/c1-21-11(19)7-5(17)6(18)10(20-7)16-3-15-4-8(12)13-2-14-9(4)16/h2-3,5-7,10-11,17-19H,1H3,(H2,12,13,14)/t5-,6+,7-,10+,11?/m0/s1 |
| InChIKey | HXYOWNKFWUCDGH-DUGQTUNHSA-N |
| XLogP | -1.90 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|