C14H23N9O4 — CID 66856589
2-[1-[[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl]-methylamino]ethyl]guanidine (PubChem CID 66856589) has the molecular formula C14H23N9O4 and a molecular weight of 381.40 g/mol. Its IUPAC name is 2-[1-[[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl]-methylamino]ethyl]guanidine.
| Compound Name | 2-[1-[[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl]-methylamino]ethyl]guanidine |
|---|---|
| PubChem CID | 66856589 |
| Molecular Formula | C14H23N9O4 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-[1-[[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl]-methylamino]ethyl]guanidine |
| SMILES | CC(N=C(N)N)N(C)C(O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H23N9O4/c1-5(21-14(16)17)22(2)12(26)9-7(24)8(25)13(27-9)23-4-20-6-10(15)18-3-19-11(6)23/h3-5,7-9,12-13,24-26H,1-2H3,(H2,15,18,19)(H4,16,17,21)/t5?,7-,8+,9-,12?,13+/m0/s1 |
| InChIKey | ZDNYUVXWQAONHQ-YKKJTRNISA-N |
| XLogP | -3.10 |
| TPSA | 207.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|