C26H36N16O12 — CID 54600687
3-[2-[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]-1-methyl-1-nitrosourea (PubChem CID 54600687) has the molecular formula C26H36N16O12 and a molecular weight of 764.67 g/mol. Its IUPAC name is 3-[2-[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]-1-methyl-1-nitrosourea.
| Compound Name | 3-[2-[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]-1-methyl-1-nitrosourea |
|---|---|
| PubChem CID | 54600687 |
| Molecular Formula | C26H36N16O12 |
| Molecular Weight | 764.67 g/mol |
| Exact Mass | 764.27 |
| IUPAC Name | 3-[2-[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]-1-methyl-1-nitrosourea |
| SMILES | CN(N=O)C(=O)NCC(O)C1OC(n2cnc3c(N)ncnc32)C(O)C1O.CN(N=O)C(=O)NCC(O)C1OC(n2cnc3c(N)ncnc32)C(O)C1O |
| InChI | InChI=1S/2C13H18N8O6/c2*1-20(19-26)13(25)15-2-5(22)9-7(23)8(24)12(27-9)21-4-18-6-10(14)16-3-17-11(6)21/h2*3-5,7-9,12,22-24H,2H2,1H3,(H,15,25)(H2,14,16,17) |
| InChIKey | LOCKXLWHPHOTLU-UHFFFAOYSA-N |
| XLogP | -4.58 |
| TPSA | 402.62 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.67 |
| LogP ≤ 5 | -4.58 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|