C28H41N7O9 — CID 89183706
(2S,5S)-6-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-prop-2-ynoxyoxolan-2-yl]-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 89183706) has the molecular formula C28H41N7O9 and a molecular weight of 619.68 g/mol. Its IUPAC name is (2S,5S)-6-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-prop-2-ynoxyoxolan-2-yl]-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | (2S,5S)-6-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-prop-2-ynoxyoxolan-2-yl]-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 89183706 |
| Molecular Formula | C28H41N7O9 |
| Molecular Weight | 619.68 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | (2S,5S)-6-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-prop-2-ynoxyoxolan-2-yl]-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | C#CCO[C@H]1[C@@H](O)[C@H](n2cnc3c(N)ncnc32)O[C@@H]1C[C@H](CC[C@H](NC(=O)OC(C)(C)C)C(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H41N7O9/c1-8-11-41-20-17(42-23(19(20)36)35-14-32-18-21(29)30-13-31-22(18)35)12-15(33-25(39)43-27(2,3)4)9-10-16(24(37)38)34-26(40)44-28(5,6)7/h1,13-17,19-20,23,36H,9-12H2,2-7H3,(H,33,39)(H,34,40)(H,37,38)(H2,29,30,31)/t15-,16-,17+,19+,20+,23+/m0/s1 |
| InChIKey | ABNOJXJXIMORQP-BUBAVSPTSA-N |
| XLogP | 1.73 |
| TPSA | 222.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.68 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|