C17H27N7O5 — CID 71497791
(2S,5S)-2-amino-6-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-5-(ethylamino)hexanoic acid (PubChem CID 71497791) has the molecular formula C17H27N7O5 and a molecular weight of 409.45 g/mol. Its IUPAC name is (2S,5S)-2-amino-6-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-5-(ethylamino)hexanoic acid.
| Compound Name | (2S,5S)-2-amino-6-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-5-(ethylamino)hexanoic acid |
|---|---|
| PubChem CID | 71497791 |
| Molecular Formula | C17H27N7O5 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (2S,5S)-2-amino-6-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-5-(ethylamino)hexanoic acid |
| SMILES | CCN[C@@H](CC[C@H](N)C(=O)O)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H27N7O5/c1-2-20-8(3-4-9(18)17(27)28)5-10-12(25)13(26)16(29-10)24-7-23-11-14(19)21-6-22-15(11)24/h6-10,12-13,16,20,25-26H,2-5,18H2,1H3,(H,27,28)(H2,19,21,22)/t8-,9-,10+,12+,13+,16+/m0/s1 |
| InChIKey | PKZUUVWXGLUIEM-WHUDRKENSA-N |
| XLogP | -1.41 |
| TPSA | 194.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |