C14H17N5O7 — CID 69101122
2-[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]butanedioic acid (PubChem CID 69101122) has the molecular formula C14H17N5O7 and a molecular weight of 367.32 g/mol. Its IUPAC name is 2-[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]butanedioic acid.
| Compound Name | 2-[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]butanedioic acid |
|---|---|
| PubChem CID | 69101122 |
| Molecular Formula | C14H17N5O7 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]butanedioic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CC(CC(=O)O)C(=O)O)C(O)C1O |
| InChI | InChI=1S/C14H17N5O7/c15-11-8-12(17-3-16-11)19(4-18-8)13-10(23)9(22)6(26-13)1-5(14(24)25)2-7(20)21/h3-6,9-10,13,22-23H,1-2H2,(H,20,21)(H,24,25)(H2,15,16,17)/t5?,6-,9?,10?,13-/m1/s1 |
| InChIKey | UYQVKJRMCSWIIN-WNEFHGIWSA-N |
| XLogP | -1.41 |
| TPSA | 193.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |