C17H26LiN6O7S — CID 173246457
CID 173246457 (PubChem CID 173246457) has the molecular formula C17H26LiN6O7S and a molecular weight of 465.44 g/mol.
| Compound Name | CID 173246457 |
|---|---|
| PubChem CID | 173246457 |
| Molecular Formula | C17H26LiN6O7S |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | — |
| SMILES | CC(=O)[O-].C[S+](CC[C@H](N)C(=O)O)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O.[Li] |
| InChI | InChI=1S/C15H22N6O5S.C2H4O2.Li/c1-27(3-2-7(16)15(24)25)4-8-10(22)11(23)14(26-8)21-6-20-9-12(17)18-5-19-13(9)21;1-2(3)4;/h5-8,10-11,14,22-23H,2-4,16H2,1H3,(H2-,17,18,19,24,25);1H3,(H,3,4);/t7-,8+,10+,11+,14+,27?;;/m0../s1 |
| InChIKey | ZEVLAEKMMJQYGG-NGKVPNEUSA-N |
| XLogP | -3.55 |
| TPSA | 222.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|