C15H24N6O12S3 — CID 87839102
2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylsulfonio]butanoate;sulfo hydrogen sulfate (PubChem CID 87839102) has the molecular formula C15H24N6O12S3 and a molecular weight of 576.59 g/mol. Its IUPAC name is 2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylsulfonio]butanoate;sulfo hydrogen sulfate.
| Compound Name | 2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylsulfonio]butanoate;sulfo hydrogen sulfate |
|---|---|
| PubChem CID | 87839102 |
| Molecular Formula | C15H24N6O12S3 |
| Molecular Weight | 576.59 g/mol |
| Exact Mass | 576.06 |
| IUPAC Name | 2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylsulfonio]butanoate;sulfo hydrogen sulfate |
| SMILES | C[S+](CCC(N)C(=O)[O-])C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O.O=S(=O)(O)OS(=O)(=O)O |
| InChI | InChI=1S/C15H22N6O5S.H2O7S2/c1-27(3-2-7(16)15(24)25)4-8-10(22)11(23)14(26-8)21-6-20-9-12(17)18-5-19-13(9)21;1-8(2,3)7-9(4,5)6/h5-8,10-11,14,22-23H,2-4,16H2,1H3,(H2-,17,18,19,24,25);(H,1,2,3)(H,4,5,6)/t7?,8-,10-,11-,14-,27?;/m1./s1 |
| InChIKey | SPPUWRPUILRWPC-YZWDQNTRSA-N |
| XLogP | -4.65 |
| TPSA | 303.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.59 |
| LogP ≤ 5 | -4.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|