C21H29N6O11S3+ — CID 10349144
[(3S)-3-amino-3-carboxypropyl]-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium;benzene-1,2-disulfonic acid (PubChem CID 10349144) has the molecular formula C21H29N6O11S3+ and a molecular weight of 637.70 g/mol. Its IUPAC name is [(3S)-3-amino-3-carboxypropyl]-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium;benzene-1,2-disulfonic acid.
| Compound Name | [(3S)-3-amino-3-carboxypropyl]-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium;benzene-1,2-disulfonic acid |
|---|---|
| PubChem CID | 10349144 |
| Molecular Formula | C21H29N6O11S3+ |
| Molecular Weight | 637.70 g/mol |
| Exact Mass | 637.11 |
| IUPAC Name | [(3S)-3-amino-3-carboxypropyl]-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium;benzene-1,2-disulfonic acid |
| SMILES | C[S+](CC[C@H](N)C(=O)O)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O.O=S(=O)(O)c1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C15H22N6O5S.C6H6O6S2/c1-27(3-2-7(16)15(24)25)4-8-10(22)11(23)14(26-8)21-6-20-9-12(17)18-5-19-13(9)21;7-13(8,9)5-3-1-2-4-6(5)14(10,11)12/h5-8,10-11,14,22-23H,2-4,16H2,1H3,(H2-,17,18,19,24,25);1-4H,(H,7,8,9)(H,10,11,12)/p+1/t7-,8+,10+,11+,14+,27?;/m0./s1 |
| InChIKey | JTILXDRPNUUIBE-XKGORWRGSA-O |
| XLogP | -1.74 |
| TPSA | 291.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.70 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|