C25H31N6O12S3- — CID 10055543
[(3S)-3-amino-3-carboxypropyl]-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium;naphthalene-1-sulfonic acid;sulfate (PubChem CID 10055543) has the molecular formula C25H31N6O12S3- and a molecular weight of 703.75 g/mol. Its IUPAC name is [(3S)-3-amino-3-carboxypropyl]-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium;naphthalene-1-sulfonic acid;sulfate.
| Compound Name | [(3S)-3-amino-3-carboxypropyl]-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium;naphthalene-1-sulfonic acid;sulfate |
|---|---|
| PubChem CID | 10055543 |
| Molecular Formula | C25H31N6O12S3- |
| Molecular Weight | 703.75 g/mol |
| Exact Mass | 703.12 |
| IUPAC Name | [(3S)-3-amino-3-carboxypropyl]-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium;naphthalene-1-sulfonic acid;sulfate |
| SMILES | C[S+](CC[C@H](N)C(=O)O)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O.O=S(=O)(O)c1cccc2ccccc12.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C15H22N6O5S.C10H8O3S.H2O4S/c1-27(3-2-7(16)15(24)25)4-8-10(22)11(23)14(26-8)21-6-20-9-12(17)18-5-19-13(9)21;11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;1-5(2,3)4/h5-8,10-11,14,22-23H,2-4,16H2,1H3,(H2-,17,18,19,24,25);1-7H,(H,11,12,13);(H2,1,2,3,4)/p-1/t7-,8+,10+,11+,14+,27?;;/m0../s1 |
| InChIKey | IUOUTNUXWBLSDW-NGKVPNEUSA-M |
| XLogP | -1.17 |
| TPSA | 317.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.75 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|