C15H25IN6O3S — CID 118725209
3-aminobutyl-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium iodide (PubChem CID 118725209) has the molecular formula C15H25IN6O3S and a molecular weight of 496.38 g/mol. Its IUPAC name is 3-aminobutyl-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium iodide.
| Compound Name | 3-aminobutyl-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium iodide |
|---|---|
| PubChem CID | 118725209 |
| Molecular Formula | C15H25IN6O3S |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | 3-aminobutyl-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium iodide |
| SMILES | CC(N)CC[S+](C)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O.[I-] |
| InChI | InChI=1S/C15H25N6O3S.HI/c1-8(16)3-4-25(2)5-9-11(22)12(23)15(24-9)21-7-20-10-13(17)18-6-19-14(10)21;/h6-9,11-12,15,22-23H,3-5,16H2,1-2H3,(H2,17,18,19);1H/q+1;/p-1/t8?,9-,11-,12-,15-,25?;/m1./s1 |
| InChIKey | AYTCHHFMDZTTDO-MEVYLOQOSA-M |
| XLogP | -3.98 |
| TPSA | 145.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|