C14H21N7O5S — CID 172761970
N-amino-N-[2-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylsulfonio]ethyl]carbamate (PubChem CID 172761970) has the molecular formula C14H21N7O5S and a molecular weight of 399.43 g/mol. Its IUPAC name is N-amino-N-[2-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylsulfonio]ethyl]carbamate.
| Compound Name | N-amino-N-[2-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylsulfonio]ethyl]carbamate |
|---|---|
| PubChem CID | 172761970 |
| Molecular Formula | C14H21N7O5S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-amino-N-[2-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylsulfonio]ethyl]carbamate |
| SMILES | C[S+](CCN(N)C(=O)[O-])C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H21N7O5S/c1-27(3-2-21(16)14(24)25)4-7-9(22)10(23)13(26-7)20-6-19-8-11(15)17-5-18-12(8)20/h5-7,9-10,13,22-23H,2-4,16H2,1H3,(H2-,15,17,18,24,25)/t7-,9-,10-,13-,27?/m1/s1 |
| InChIKey | LUPUXIOFRRESQH-OQEAWBJFSA-N |
| XLogP | -3.21 |
| TPSA | 188.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|