C18H28N7O6S+ — CID 56666160
[(3S)-3-(3-aminopropanoylamino)-3-carboxypropyl]-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium (PubChem CID 56666160) has the molecular formula C18H28N7O6S+ and a molecular weight of 470.53 g/mol. Its IUPAC name is [(3S)-3-(3-aminopropanoylamino)-3-carboxypropyl]-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium.
| Compound Name | [(3S)-3-(3-aminopropanoylamino)-3-carboxypropyl]-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium |
|---|---|
| PubChem CID | 56666160 |
| Molecular Formula | C18H28N7O6S+ |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | [(3S)-3-(3-aminopropanoylamino)-3-carboxypropyl]-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium |
| SMILES | C[S+](CC[C@H](NC(=O)CCN)C(=O)O)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H27N7O6S/c1-32(5-3-9(18(29)30)24-11(26)2-4-19)6-10-13(27)14(28)17(31-10)25-8-23-12-15(20)21-7-22-16(12)25/h7-10,13-14,17,27-28H,2-6,19H2,1H3,(H3-,20,21,22,24,26,29,30)/p+1/t9-,10+,13+,14+,17+,32?/m0/s1 |
| InChIKey | RJZNUPICQWHSDJ-CSPFVMHMSA-O |
| XLogP | -2.42 |
| TPSA | 211.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|