C17H29N9O5 — CID 71008860
(2S,5S)-2,5-diamino-6-[(2R,3S,4R,5R)-5-[6-amino-2-(2-aminoethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]hexanoic acid (PubChem CID 71008860) has the molecular formula C17H29N9O5 and a molecular weight of 439.48 g/mol. Its IUPAC name is (2S,5S)-2,5-diamino-6-[(2R,3S,4R,5R)-5-[6-amino-2-(2-aminoethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]hexanoic acid.
| Compound Name | (2S,5S)-2,5-diamino-6-[(2R,3S,4R,5R)-5-[6-amino-2-(2-aminoethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 71008860 |
| Molecular Formula | C17H29N9O5 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | (2S,5S)-2,5-diamino-6-[(2R,3S,4R,5R)-5-[6-amino-2-(2-aminoethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]hexanoic acid |
| SMILES | NCCNc1nc(N)c2ncn([C@@H]3O[C@H](C[C@@H](N)CC[C@H](N)C(=O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C17H29N9O5/c18-3-4-22-17-24-13(21)10-14(25-17)26(6-23-10)15-12(28)11(27)9(31-15)5-7(19)1-2-8(20)16(29)30/h6-9,11-12,15,27-28H,1-5,18-20H2,(H,29,30)(H3,21,22,24,25)/t7-,8-,9+,11+,12+,15+/m0/s1 |
| InChIKey | LVVQFNZVOFFENM-TVDBPQCTSA-N |
| XLogP | -2.69 |
| TPSA | 246.70 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |