C24H42N10O8S — CID 71043112
(2S)-2-amino-4-[[(2R,3S,4R,5R)-5-[6-amino-2-[2-[6-(methanesulfonamido)hexanoylamino]ethylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]butanoic acid (PubChem CID 71043112) has the molecular formula C24H42N10O8S and a molecular weight of 630.73 g/mol. Its IUPAC name is (2S)-2-amino-4-[[(2R,3S,4R,5R)-5-[6-amino-2-[2-[6-(methanesulfonamido)hexanoylamino]ethylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[[(2R,3S,4R,5R)-5-[6-amino-2-[2-[6-(methanesulfonamido)hexanoylamino]ethylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]butanoic acid |
|---|---|
| PubChem CID | 71043112 |
| Molecular Formula | C24H42N10O8S |
| Molecular Weight | 630.73 g/mol |
| Exact Mass | 630.29 |
| IUPAC Name | (2S)-2-amino-4-[[(2R,3S,4R,5R)-5-[6-amino-2-[2-[6-(methanesulfonamido)hexanoylamino]ethylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]butanoic acid |
| SMILES | CN(CC[C@H](N)C(=O)O)C[C@H]1O[C@@H](n2cnc3c(N)nc(NCCNC(=O)CCCCCNS(C)(=O)=O)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H42N10O8S/c1-33(11-7-14(25)23(38)39)12-15-18(36)19(37)22(42-15)34-13-29-17-20(26)31-24(32-21(17)34)28-10-9-27-16(35)6-4-3-5-8-30-43(2,40)41/h13-15,18-19,22,30,36-37H,3-12,25H2,1-2H3,(H,27,35)(H,38,39)(H3,26,28,31,32)/t14-,15+,18+,19+,22+/m0/s1 |
| InChIKey | ITSZQOKTKMLVES-KSHOWADASA-N |
| XLogP | -2.60 |
| TPSA | 273.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.73 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|